Name | 6-chloroimidazo[1,2-a]pyrazine |
Synonyms | LogP 6-chloroimidazo[1,2-a]pyrazine 6-Chloro-imidazo[1,2-a]pyrazine 6-Chloro-Imidazo[1,2-A]Pyrazine imidazo[1,2-a]pyrazine, 6-chloro- Imidazo[1,2-a]pyrazine, 6-chloro- |
CAS | 76537-23-0 |
InChI | InChI=1/C6H4ClN3/c7-5-4-10-2-1-8-6(10)3-9-5/h1-4H |
Molecular Formula | C6H4ClN3 |
Molar Mass | 153.57 |
Density | 1.51 |
Melting Point | 137-138℃ |
pKa | 2.68±0.30(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Refractive Index | 1.712 |
use | 6-chlorimidazole [1,2A] pyrazine is a heterocyclic derivative and can be used as a pharmaceutical intermediate. |
preparation | taking 2-aminopyrazine as the starting material, through chlorination reaction and imidization reaction, the ring is condensed to synthesize the target product 6-chlorimidazolo [1,2-a] pyrazine, this method has the advantages of novel preparation method, cheap and easy to obtain raw materials, purification by crystallization method, avoiding column chromatography separation, easy to scale up production, and the total yield of the reaction is obviously improved. The synthesis reaction formula of 6-chlorimidazolo [1,2-a] pyrazine is as follows: |