| Name | N,N''-(Isobutylidene)bisurea IBDU |
| Synonyms | IBDU Isobutylenediurea. 1,1-diureidisobutane Isobutylidene biurea Isobutylidendiharnstoff 1,1'-isobutylidenedi-urea 1,1'-isobutylidenebisurea N,N''-(isobutylidene)diurea N,N''-(Isobutylidene)bisurea Urea, N,N-(2-methylpropylidene)bis- 1,1'-(2-methylpropane-1,1-diyl)diurea |
| CAS | 6104-30-9 |
| EINECS | 228-055-8 |
| InChI | InChI=1/C4H8.2CH4N2O/c1-4(2)3;2*2-1(3)4/h1H2,2-3H3;2*(H4,2,3,4) |
| Molecular Formula | C6H14N4O2 |
| Molar Mass | 174.2 |
| Density | 1.2297 (rough estimate) |
| Melting Point | 195 °C |
| Boling Point | 305.18°C (rough estimate) |
| pKa | 12.55±0.46(Predicted) |
| Refractive Index | 1.6700 (estimate) |
| Use | With the slow release of nitrogen properties, it is widely used in horticulture, turf, etc |
| HS Code | 2924190002 |
| Raw Materials | Urea Urea Isobutyraldehyde |
| LogP | -0.903 at 20-23℃ |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | has the performance of slowly releasing nitrogen, so it is widely used in gardening, lawn, etc. |