| Name | tri-P-tolylamine |
| Synonyms | TMTPA Benzena TRI-P-TOLYLAMINE tri-P-tolylamine Triphenyldiamine N,N-Di-p-tolyl-p-toluidine 4,4',4'-Trimethyltriphenylamine TRIS(4 METHYL TRI PHENYL) AMINE 4,4',4''-TRIMETHYLTRIPHENYLAMINE 4,4',4''-trimethyltriphenylamine 4,4'4''-Trimethyl triphenylamine 4,4',4''-Trimethyl triphenylamine 4-methyl-N,N-bis(4-methylphenyl)aniline 4-methyl-n,n-bis(4-methylphenyl)-benzenamin |
| CAS | 1159-53-1 |
| EINECS | 214-595-1 |
| InChI | InChI=1/C21H21N/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| Molecular Formula | C21H21N |
| Molar Mass | 287.4 |
| Density | 1.10 g/cm3 |
| Melting Point | 114-118°C |
| Boling Point | 170 °C / 0.1mmHg |
| Flash Point | 191.1°C |
| Solubility | Soluble in chloroform and tetrahydrofuran (THF). |
| Vapor Presure | 1.05E-07mmHg at 25°C |
| Appearance | Crystalline powder |
| Color | White to off-white |
| pKa | -1.76±0.50(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.619 |
| MDL | MFCD00674043 |
| Physical and Chemical Properties |
|
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29214990 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |