| Name | diphenhydramine |
| Synonyms | Vena Syntedril Syntodril AURORA KA-7664 Diphenyldramine DIPHENHYDRAMINE diphenhydramine DIPHENHYDRAMINE BASE 2-benzhydryloxyethyldimethylamine n,n-dimethyl-4,4-diphenyl-3-oxabutylamine |
| CAS | 58-73-1 |
| EINECS | 200-396-7 |
| InChI | InChI=1/C17H21NO/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3 |
| Molecular Formula | C17H21NO |
| Molar Mass | 255.35 |
| Density | 0.9889 (rough estimate) |
| Melting Point | 167-172°C |
| Boling Point | bp2.0 150-165° |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Oil |
| Color | Oil |
| Merck | 14,3309 |
| pKa | pKa 9.1 (Uncertain) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.5450 to 1.5490 |
| Physical and Chemical Properties | Its hydrochloride is commonly used. White crystalline powder. Odorless. Bitter in taste, with subsequent paralysis. The color gradually changed in sunlight. Melting point 166-170 °c. Soluble in water, ethanol, chloroform, ether-soluble or benzene. Ethanolamine antihistamine. |
| Use | For the skin and mucous membranes of allergic diseases and Nausea caused by a boat ride Vomit. |
| RTECS | KR6825000 |
| Toxicity | LD50 oral in rat: 390mg/kg |