| Name | Isoquinolin-8-amine |
| Synonyms | 8-Isoquinolinamine Isoquinolin-8-amine 8-Aminoisoquinoline ISOQUINOLIN-8-AMINE 8-AMINOISOQUINOLINE 8-amine-isoquinoline ISOQUINOLIN-8-YLAMINE |
| CAS | 23687-27-6 |
| EINECS | 691-616-4 |
| InChI | InChI=1/C9H8N2/c10-9-3-1-2-7-4-5-11-6-8(7)9/h1-6H,10H2 |
| Molecular Formula | C9H8N2 |
| Molar Mass | 144.17 |
| Density | 1.210±0.06 g/cm3(Predicted) |
| Melting Point | 155-157 |
| Boling Point | 335.7±17.0 °C(Predicted) |
| Flash Point | 183.349°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Solid |
| Color | Brown |
| pKa | 6.20±0.23(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,2-8°C |
| Refractive Index | 1.708 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |
| HS Code | 29334900 |
| Hazard Note | Harmful/Irritant/Keep Cold |