| Name | 2'-methylacetanilide |
| Synonyms | Acet-o-toluidide o-Acetotoluidine 2-Methylacetaniline 2'-methylacetanilide Prilocaine Impurity 16 n-(2-methylphenyl)-acetamid N-(2-Methylphenyl)acetamide Acetamide,N-(2-methylphenyl)- N-Acetyl-o-toluidine2'-Methylacetanilide |
| CAS | 120-66-1 |
| EINECS | 204-414-4 |
| InChI | InChI=1/C9H11NO/c1-7-5-3-4-6-9(7)10-8(2)11/h3-6H,1-2H3,(H,10,11) |
| Molecular Formula | C9H11NO |
| Molar Mass | 149.19 |
| Density | 1.16 |
| Melting Point | 109-112 °C |
| Boling Point | 296 °C |
| Flash Point | 296°C |
| Solubility | It is slightly soluble in acetone, chloroform, toluene, benzene. |
| Vapor Presure | 0.001mmHg at 25°C |
| Appearance | White powder or crystal |
| Color | Needles |
| Merck | 14,74 |
| BRN | 2207054 |
| pKa | 15.13±0.70(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5279 (estimate) |
| MDL | MFCD00014961 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37 - Wear suitable protective clothing and gloves. |
| RTECS | AN2900000 |
| TSCA | Yes |
| HS Code | 29242990 |
| Hazard Note | Harmful |
| Toxicity | mma-sat 1 mg/plate NTPTB* JAN 82 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | oral-mouse LD50: 1450 mg/kg |
| flammability hazard characteristics | flammability; heating decomposition releases toxic nitrogen oxide smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |