| Name | 2-Amino-4-acetamino anisole |
| Synonyms | 5-ACETAMIDO-O-ANISIDINE 4-ACETAMINO-2-AMINOANISOLE 2-Amino-4-acetamino anisole 3-AMINO-4-METHOXYACETANILINE 3-AMINO-4-METHOXY ACETANILIDE 3'-Amino-4'-methoxyacetanilide 3'-AMINO-4'-METHOXYACETANILIDE 3'-AMINO-4'-METHOXYACETOANILIDE 4-ACETOAMINO-2-AMINO METHOXYBENZENE n-(3-amino-4-methoxyphenyl)-acetamid N-(3-amino-4-methoxyphenyl)-acetamide 3,3-bis(4-hydroxy-3-methoxyphenyl)-1,3-dihydro-2H-indol-2-one |
| CAS | 6375-47-9 |
| EINECS | 228-938-8 |
| InChI | InChI=1/C22H19NO5/c1-27-19-11-13(7-9-17(19)24)22(14-8-10-18(25)20(12-14)28-2)15-5-3-4-6-16(15)23-21(22)26/h3-12,24-25H,1-2H3,(H,23,26) |
| InChIKey | SJWQCBCAGCEWCV-UHFFFAOYSA-N |
| Molecular Formula | C9H12N2O2 |
| Molar Mass | 180.2 |
| Density | 1.1819 (rough estimate) |
| Melting Point | 109°C |
| Boling Point | 313.03°C (rough estimate) |
| Flash Point | 321°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 2.46E-15mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Gray to Brown |
| pKa | 14.23±0.70(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.5373 (estimate) |
| Physical and Chemical Properties | White crystals. Melting point 116-118 °c. |
| Use | For the production of dye intermediates such as Disperse Blue 79# |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 1 |
| Hazard Class | IRRITANT |
Nature:
1. 2-Amino-4-acetylaminoanisole is a white to almost white solid powder, slightly soluble in water, and soluble in ethanol and ether.
2. It is an organic compound, a derivative of benzyl ether with amino and acetylamino groups.
Usage:
2-Amino-4-acetylaminobenzyl ether is mainly used as an intermediate in organic synthesis and can be used to synthesize other compounds, such as dyes and other fields.
Method:
The preparation method of 2-amino-4-acetylaminobenzyl ether generally involves the reaction of benzyl ether and chloroacetamide under alkaline conditions.
Security information:
1. Avoid contact with skin, eyes, and inhalation.
2. Attention should be paid to protective measures during use and storage to avoid the risk of fire and explosion.
3. When disposing of waste, it should comply with local environmental regulations.
4. Appropriate personal protective equipment (such as gloves, goggles, etc.) should be worn during handling.
5. If taken or inhaled by mistake, seek medical attention immediately.