| Name | 1-pyrenemethanol |
| Synonyms | Pyrenemethanol 1-PYRENEMETHANOL 1-pyrenemethanol 3-Pyrenylmethanol 1-Pyrenylmethanol (1-Pyrenyl)methanol RARECHEM AL BD 0667 1-(HYDROXYMETHYL)PYRENE |
| CAS | 24463-15-8 |
| InChI | InChI=1/C17H12O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9,18H,10H2 |
| Molecular Formula | C17H12O |
| Molar Mass | 232.28 |
| Density | 1.321±0.06 g/cm3(Predicted) |
| Melting Point | 123-126 °C (lit.) |
| Boling Point | 455.2±14.0 °C(Predicted) |
| Flash Point | 207.5°C |
| Solubility | Soluble in Methanol |
| Vapor Presure | 4.46E-09mmHg at 25°C |
| Appearance | Solid |
| Color | Pale Green to Yellow |
| pKa | 14.36±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.855 |
| MDL | MFCD00029252 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | UR2457242 |
| HS Code | 29062990 |