| Name | 1,1'-Bi-2-naphthol |
| Synonyms | (±)-BINOL BI-2-NAPHTHOL DI-B-NAPHTHOL AURORA KA-7212 1,1'-Bi-naphthol 1,1'-Bi-2-naphthol (±)-1,1'-Bi-2-naphthol (±)-1,1'-Bi(2-naphthol) (R)-(+)-1,1'-BI(2,2'-NAPHTHOL) |
| CAS | 602-09-5 |
| EINECS | 210-014-0 |
| InChI | InChI=1/C20H14O2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,21-22H |
| InChIKey | PPTXVXKCQZKFBN-UHFFFAOYSA-N |
| Molecular Formula | C20H14O2 |
| Molar Mass | 286.32 |
| Density | 1g/cm |
| Melting Point | 215-218°C |
| Boling Point | 388.69°C (rough estimate) |
| Flash Point | 218.9°C |
| Water Solubility | insoluble |
| Solubility | Dioxane: 50 mg/ml |
| Vapor Presure | 3.68E-09mmHg at 25°C |
| Appearance | White to light brown powder |
| Color | White to beige |
| Merck | 14,1226 |
| BRN | 997518 |
| pKa | 8.29±0.50(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.7580 (estimate) |
| MDL | MFCD00004068 |
| Physical and Chemical Properties | Melting point 215-218°C. Soluble in water. |
| Use | Chiral resolution agent is widely used in chiral synthesis of chiral liquid crystals, drugs, fragrances and pesticides. |
| Risk Codes | R25 - Toxic if swallowed R36 - Irritating to the eyes R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DU3106100 |
| FLUKA BRAND F CODES | 10 |
| TSCA | Yes |
| HS Code | 29072900 |
| Hazard Class | 6.1 |
| Packing Group | III |
| Toxicity | LDLo orl-mus: 42 mg/kg AECTCV 14,111,85 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Introduction | 1,1 '-bi-2-naphthol is a white to yellow-gray crystalline powder, soluble in methanol. Can be stored in a cool and dark place to maintain the best condition. |
| Application | 1,1 '-bi-2-naphthol can be alkynylated, diels-Alder and asymmetric Michael addition reaction as chiral ligands. |
| Use | chiral resolution agent, widely used in chiral liquid crystal, medicine, perfume, pesticide Chiral synthesis. |
| category | toxic substances |
| toxicity grade | high toxicity |
| Acute toxicity | oral-mouse LDL0: 42 mg/kg |
| flammability hazard characteristics | flammable; Combustion-induced irritating smoke |
| storage and transportation characteristics | ventilation and low temperature drying; Separate storage |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, water mist |