| Name | (R)-N,N-Dimethyl-1-[(S)-2-(diphenylphosphino)ferrocenyl]ethylamine |
| Synonyms | (R)-(S)-PPFA Josiphos SL-0000-2 (-)-(R)-N,N-dimethyl-1-((S)-2-(diphenyl-phosphino (R)-N,N-Dimethyl-1-((S)-2-(diphenylphosphino)ferro (R)-(-)-N,N-Dimethyl-1-(2-diphenylphosphino)ferrocenylethylamine (R)-(-)-N,N-DIMETHYL-1-(2-DIPHENYLPHOSPHINO)FERROCENYLETHYLAMINE (R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE (R)-N,N-Dimethyl-1-[(S)-2-(diphenylphosphino)ferrocenyl]ethylamine (R) -NN-dimethyl-1-((S) -2-diphenylphosphorus) ferrocene) ethylamine (-)-(R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE |
| CAS | 55700-44-2 |
| EINECS | 633-502-9 |
| InChI | InChI=1/C21H23NP.C5H5.Fe/c1-17(22(2)3)20-15-10-16-21(20)23(18-11-6-4-7-12-18)19-13-8-5-9-14-19;1-2-4-5-3-1;/h4-17H,1-3H3;1-5H;/t17-;;/m1../s1 |
| Molecular Formula | C26H28FeNP10* |
| Molar Mass | 441.33 |
| Melting Point | 141-143°C(lit.) |
| Specific Rotation(α) | -355 º (C=0.6 IN ETOH) |
| Water Solubility | Insoluble in water. |
| Appearance | solid |
| Color | Light yellow to Yellow to Orange |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Sensitive | Air Sensitive |
| MDL | MFCD00075286 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/38 - |
| UN IDs | 3288 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Hazard Class | 6.1 |
| Packing Group | III |
| Use | a ligand for an asymmetric ethenylation reaction of an aldehyde. |