| Name | 5-Fluoro-2-methylindole |
| Synonyms | 5-FLUORO-2-METHYLINDOLE 5-Fluoro-2-methylindole 5-FLUORO-2-METHYL-1H-INDOLE 5-Fluoro-2-methyl-1H-indole 1H-Indole, 5-fluoro-2-methyl- 5-fluoro-2-methyl-1,3-benzothiazole |
| CAS | 399-72-4 |
| EINECS | 609-764-5 |
| InChI | InChI=1/C9H8FN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-5,11H,1H3 |
| InChIKey | JJIUISYYTFDATN-UHFFFAOYSA-N |
| Molecular Formula | C9H8FN |
| Molar Mass | 149.16 |
| Density | 1.219±0.06 g/cm3(Predicted) |
| Melting Point | 98-101 °C (lit.) |
| Boling Point | 112-120C |
| Flash Point | 116.6°C |
| Vapor Presure | 0.0121mmHg at 25°C |
| Appearance | Solid |
| pKa | 16.73±0.30(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.626 |
| MDL | MFCD02093649 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R25 - Toxic if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| Hazard Note | Irritant |