| Name | 2-(1-adamantyl)-4-methylphenol |
| Synonyms | 2-(1-Adamantyl)-p-cresol 2-(AdaMantyl)-4-Methylphenol 2-(1-adamantyl)-4-methylphenol 2-(1-ADAMANTYL)-4-METHYLPHENOL 2-(AdaMantan-1-yl)-4-Methylphenol phenol, 4-methyl-2-tricyclo[3.3.1.1~3,7~]dec-1-yl- |
| CAS | 41031-50-9 |
| InChI | InChI=1/C17H22O/c1-11-2-3-16(18)15(4-11)17-8-12-5-13(9-17)7-14(6-12)10-17/h2-4,12-14,18H,5-10H2,1H3 |
| Molecular Formula | C17H22O |
| Molar Mass | 242.36 |
| Density | 1.137±0.06 g/cm3 (20 ºC 760 Torr) |
| Melting Point | 128-130°C(lit.) |
| Boling Point | 359.9°C at 760 mmHg |
| Flash Point | 169.4°C |
| Water Solubility | Sparingly Soluble in water (7.8E-3 g/L) (25°C). |
| Vapor Presure | 1.11E-05mmHg at 25°C |
| Appearance | Powder |
| Color | White |
| Storage Condition | Room Temprature |
| Refractive Index | 1.603 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |