| Name | 3-fluoro-4-nitrophenol |
| Synonyms | 3-Fluoro-4-nitrophen 3-fluoro-4-nitrophenol 3-FLUORO-4-NITROPHENOL 3-Fluoro-4-nitro-1-phenol 3-FLUORO-4-METHYLPYRIDINE 3-fluoro-4-nitrophenolate Phenol, 3-fluoro-4-nitro- 3-FLUORO-4-NITROPHENOL (SOLID) 3-FLUORO-4-NITROPHENOL (POWDER) 3-FLUORO-4-METHYLPYRIDINE ATHX539 |
| CAS | 394-41-2 |
| EINECS | 206-895-6 |
| InChI | InChI=1/C6H4FNO3/c7-5-3-4(9)1-2-6(5)8(10)11/h1-3,9H/p-1 |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| Molecular Formula | C6H4FNO3 |
| Molar Mass | 157.1 |
| Density | 1.4306 (estimate) |
| Melting Point | 93-95 °C (lit.) |
| Boling Point | 323.6±27.0 °C(Predicted) |
| Flash Point | 149.5°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.000138mmHg at 25°C |
| Appearance | Powder |
| Color | Pale yellow to brown |
| BRN | 2048033 |
| pKa | 6.42±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Physical and Chemical Properties | Melting point 93-95°C(lit.) BRN 2048033 |
| Risk Codes | R22 - Harmful if swallowed R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN2811 |
| WGK Germany | 2 |
| HS Code | 29089000 |
| Hazard Class | IRRITANT |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | pesticide, pharmaceutical and dye intermediates |