| Name | 4-(1-Piperidino)aniline |
| Synonyms | TIMTEC-BB SBB010087 4-Piperidinoaniline 4-PIPERIDINOANILINE 4-PIPERIDIN-1-YLANILINE 4-(1-Piperidino)aniline 4-(piperidin-1-yl)aniline N-(4-aminophenyl)piperidine 1-(4-Aminophenyl)piperidine N-(4-AMINOPHENYL)PIPERIDINE 1-(p-Aminophenyl)piperidine 4-(1-PIPERIDINO)ANILINE [1-(4-AMINOPHENYL)PIPERIDINE] |
| CAS | 2359-60-6 |
| InChI | InChI=1/C11H16N2/c12-10-4-6-11(7-5-10)13-8-2-1-3-9-13/h4-7H,1-3,8-9,12H2 |
| Molecular Formula | C11H16N2 |
| Molar Mass | 176.26 |
| Density | 1.074±0.06 g/cm3(Predicted) |
| Melting Point | 26-29°C(lit.) |
| Boling Point | 140-142°C 1mm |
| Flash Point | >230°F |
| Vapor Presure | 6.32E-05mmHg at 25°C |
| BRN | 139525 |
| pKa | 7.79±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.5937(lit.) |
| MDL | MFCD00051688 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36/37 - Irritating to eyes and respiratory system. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S22 - Do not breathe dust. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Note | Harmful |
| Hazard Class | 6.1 |
| Packing Group | III |