| Name | 2-Bromo-5-chlorophenol |
| Synonyms | 2-Bromo-5-chlorophenol Phenol,2-broMo-5-chloro- phenol, 2-bromo-5-chloro- |
| CAS | 13659-23-9 |
| InChI | InChI=1/C6H4BrClO/c7-5-2-1-4(8)3-6(5)9/h1-3,9H |
| Molecular Formula | C6H4BrClO |
| Molar Mass | 207.45 |
| Density | 1.788±0.06 g/cm3(Predicted) |
| Melting Point | 88.2℃ |
| Boling Point | 222.2±20.0 °C(Predicted) |
| Flash Point | 88.159°C |
| Vapor Presure | 0.069mmHg at 25°C |
| pKa | 7.47±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.619 |
| MDL | MFCD00142870 |
| Physical and Chemical Properties | Storage Conditions: Keep Cold |
| Hazard Symbols | Xi - Irritant![]() |
| application | 2-bromo-5-chlorophenol can be used as an intermediate in organic synthesis and pharmaceutical, mainly used in laboratory research and development processes and chemical production processes. |