| Name | bis(2-(2-butoxyethoxy)ethyl) adipate |
| Synonyms | tp759 rx11806 reomolbcd thiokoltp95 thiokoltp759 plasthalldbeea di(butyldigol) adipate bis(2-(2-butoxyethoxy)ethyl) adipate Bis[2-(2-butoxyethoxy)ethyl] adipate bis[2-(2-butoxyethoxy)ethyl] hexanedioate adipicacid,bis(2-(2-butoxyethoxy)ethyl)ester Adipic acid, bis(2-(2-butoxyethoxy)ethyl) ester |
| CAS | 141-17-3 |
| EINECS | 205-465-5 |
| InChI | InChI=1/C22H42O8/c1-3-5-11-25-13-15-27-17-19-29-21(23)9-7-8-10-22(24)30-20-18-28-16-14-26-12-6-4-2/h3-20H2,1-2H3 |
| Molecular Formula | C22H42O8 |
| Molar Mass | 434.56 |
| Density | 1.01g/mLat 25°C(lit.) |
| Melting Point | −11°C(lit.) |
| Boling Point | 467.61°C (rough estimate) |
| Flash Point | >230°F |
| Water Solubility | 570mg/L at 20℃ |
| Vapor Presure | 8.35E-10mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | n20/D 1.448(lit.) |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 2 |
| RTECS | AU8420000 |
| HS Code | 29171900 |
| Toxicity | LD50 oral in rat: 6gm/kg |
| LogP | 3.24 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | can be well dissolved with natural rubber and synthetic rubber. Thereby improving the low-temperature softness of the rubber. In particular, it has good cold resistance and gasoline resistance. Mainly used for rubber, polyurethane, plastic, artificial leather, cable materials. |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |