140-26-1 - Names and Identifiers
| Name | Phenylethyl isovalerate Phenethyl 3-methylbutyrate
|
| Synonyms | FEMA 2871 isovalericacid,phenethylester 2-phenylethyl3-methylbutirate 2-Phenylethyl3-methylbutanoate .beta.-Phenylethyl isovalerate 2-Phenylethyl 3-methylbutanoate Benzylcarbinyl3-methylbutanoate 3-methylbutanoicacidphenylethylester 3-methyl-butanoicaci2-phenylethylester Butanoicacid,3-methyl-,2-phenylethylester Butanoic acid, 3-methyl-, 2-phenylethyl ester butanoic acid, 3-methyl-, 2-phenylethyl ester Phenylethyl isovalerate Phenethyl 3-methylbutyrate
|
| CAS | 140-26-1
|
| EINECS | 205-406-3 |
| InChI | InChI=1/C13H18O2/c1-11(2)10-13(14)15-9-8-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
140-26-1 - Physico-chemical Properties
| Molecular Formula | C13H18O2
|
| Molar Mass | 206.28 |
| Density | 0.974g/mLat 25°C(lit.) |
| Boling Point | 268°C(lit.) |
| Flash Point | >230°F |
| JECFA Number | 994 |
| Vapor Presure | 0.00347mmHg at 25°C |
| Color | Colorless to sltly yellow liquid |
| Odor | fruity, rosy odor |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.485(lit.) |
| Physical and Chemical Properties | Colorless to yellowish liquid. It is fragrant with chrysanthemum, fruit and rose. Boiling point 263 ℃, flash point> 100 ℃. Miscible in ethanol and most non-volatile oils, insoluble in water. Natural products are found in peppermint oil, spoil, beer, grapes, brandy, cider, etc. |
140-26-1 - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes.
|
| WGK Germany | 1 |
| RTECS | NY1511500 |
| HS Code | 29156000 |
| Toxicity | LD50 orl-rat: 6220 mg/kg VPITAR 33(5),48,74 |
140-26-1 - Introduction
Phenylethyl isovalerate; Phenyl 3-methylbutylrate, chemical formula is C12H16O2, molecular weight is 192.25.
Nature:
1. Appearance: colorless liquid, aromatic smell.
2. Solubility: soluble in alcohols, ethers and most organic solvents, insoluble in water.
3. Melting Point:-45 ℃
4. Boiling point: 232-234 ℃
5. Density: 1.003g/cm3
6. Refractive index: 1.502-1.504
7. Flash point: 99 ℃
Use:
Phenylethyl isovalerate;Phenethyl 3-methylbutylrate is often used as an ingredient in spices and flavors that give products a pleasing fruit aroma, such as fruit sugar, fruit drinks and ice cream. In addition, it can also be used as a raw material for cleaning agents, solvents and lubricants.
Preparation Method:
Phenylethyl isovalerate; Phenyl 3-methylbutanol is usually prepared by the reaction of acetophenone and isopropanol in the presence of a catalyst. The specific preparation method is as follows:
1. Mix acetophenone and isopropanol in molar ratio.
2. Add an appropriate amount of acid catalyst (such as sulfuric acid).
3. Stir the reaction solution at a lower temperature (usually 0-10°C). In regular cases, the reaction time is several hours to tens of hours.
4. After the reaction is completed, the product is purified through the steps of condensation, separation, washing and distillation.
Safety Information:
Phenylethyl isovalerate;Phenethyl 3-methylbutylrate is generally considered safe under normal conditions of use. However, it is a flammable liquid, avoid direct exposure to open flames or high temperatures. Should be stored in a cool, well-ventilated place. When in use, wear appropriate personal protective equipment such as gloves and protective glasses. If you touch your skin or eyes by accident, rinse immediately with plenty of water. If inhaled or ingested by mistake, seek medical attention immediately.
Last Update:2024-04-10 22:29:15