| Supplier Name | |
| Tel | 13512556288 |
| Mobile | 0523-87726088 |
| Website | http:// |
| Product Name | Dimethyl nitroterephthalate |
| Synonyms | 2-Nitro DIMETHYL2-NITROTEREPHTALATE Dimethyl nitroterephthalate Dimethyl-2-nitroterephthalat Dimethyl 2-nitroterephthalate Nitroterephthalic acid dimethyl ester 2-Aminoterephthalic Acid Dimethyl Ester |
| CAS | 5292-45-5;39020-35-4 |
| EINECS | 226-134-1 |
| Chemical Formula | C10H9NO6 |
| Molecular Weight | 239.18 |
| inchi | InChI=1/C12H13NO6/c1-3-18-11(14)8-5-6-9(12(15)19-4-2)10(7-8)13(16)17/h5-7H,3-4H2,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |