| Supplier Name | |
| Tel | 13512556288 |
| Mobile | 0523-87726088 |
| Website | http:// |
| Product Name | 3,5-Dinitrobenzoic acid |
| Synonyms | DNBA 3.5-Dinitr 3,5-dinitrobenzoate 3,5-nitrobenzoic acid 3,5-Dinitrobenzoic acid 3,5-DINITROBENZOIC ACID DINITROBENZOIC-3,5 ACID |
| CAS | 99-34-3 |
| EINECS | 202-751-1 |
| Chemical Formula | C7H4N2O6 |
| Molecular Weight | 212.12 |
| inchi | InChI=1/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)/p-1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |