Diphenyl-s-tetrazine - Names and Identifiers
Name | 3,6-diphenyl-1,2,4,5-tetrazine
|
Synonyms | NSC 73054 Diphenyl-s-tetrazine 3,6-Diphenyltetrazine 2,6-diphenyl-s-tetrazin 3,6-Diphenyl-s-tetrazine s-Tetrazine, 3,6-diphenyl- s-Tetrazine, 2,6-diphenyl- 3,6-Diphenyl-sym-tetrazine 4,5-tetrazine,3,6-diphenyl-2 3,6-Diphenyl-1,2,4,5-tetrazine 3,6-diphenyl-1,2,4,5-tetrazine 3,6-Diphenyl-1,2,4,5-tetraazine 1,2,4,5-Tetrazine, 3,6-diphenyl- s-Tetrazine, 3,6-diphenyl- (8CI)
|
CAS | 6830-78-0
|
InChI | InChI=1/C14H10N4/c1-3-7-11(8-4-1)13-15-17-14(18-16-13)12-9-5-2-6-10-12/h1-10H |
Diphenyl-s-tetrazine - Physico-chemical Properties
Molecular Formula | C14H10N4
|
Molar Mass | 234.26 |
Density | 1.214±0.06 g/cm3(Predicted) |
Melting Point | 198 °C (dec.) (lit.) |
Boling Point | 446.0±28.0 °C(Predicted) |
Solubility | chloroform: soluble25mg/mL, clear, very dark red |
Appearance | Solid |
Color | Dark Purple |
pKa | 0.36±0.10(Predicted) |
Storage Condition | Hygroscopic, Refrigerator, under inert atmosphere |
Stability | Hygroscopic |
Diphenyl-s-tetrazine - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
|
WGK Germany | 3 |
RTECS | XF6863300 |
Diphenyl-s-tetrazine - Introduction
3,6-diphenyl-1,2,4,5-tetrazine is an organic compound with the chemical formula C14H8N4. Its main properties are as follows:
1. Appearance: 3,6-diphenyl-1,2,4,5-tetrazine is a colorless crystal or light yellow powder.
2. melting point: its melting point is about 270-275 ℃.
3. Solubility: 3,6-diphenyl-1,2,4,5-tetrazine has low solubility in common organic solvents.
4. Stability: It is a relatively stable compound, but photochemical reactions may occur when subjected to light or other external stimuli.
The main applications of 3,6-diphenyl-1,2,4,5-tetrazine are as follows:
1. photosensitizer: it can be used as a photochemical reaction material for the preparation of photosensitive materials, light valves and photochromic materials.
2. display material: due to its high electron affinity and conductivity, 3,6-diphenyl-1,2,4,5-tetrazine can be used to prepare display devices such as organic light emitting diodes (OLEDs) and organic field effect transistors (OFETs).
3. Combustion improperer: It can be used as a combustion improperer to increase the combustion speed and combustion temperature.
The preparation method of 3,6-diphenyl-1,2,4,5-tetrazine is similar to that of general tetrazine compounds, and can be prepared by reacting aniline and potassium perchlorate (KClO3) under appropriate conditions. The specific preparation method can be searched for in detail.
The following safety information is required when using, storing and handling 3,6-diphenyl-1,2,4,5-tetrazine:
1. Thermal stability: 3,6-diphenyl-1,2,4,5-tetrazine has a high melting point, and attention should be paid to avoid unnecessary danger caused by excessive temperature.
2. Operating conditions: During operation, it is recommended to wear appropriate personal protective equipment, such as laboratory gloves, goggles and laboratory coats.
3. protective measures: 3,6-diphenyl-1,2,4,5-tetrazine is a combustible material, should be away from the fire or high temperature ignition source. Avoid violent reactions with oxidants and strong acids.
4. storage conditions: 3,6-diphenyl-1,2,4,5-tetrazine should be stored in a cool, dry place, and away from organic solvents and flame and other flammable materials.
In summary, 3,6-diphenyl-1,2,4,5-tetrazine is an organic compound with multiple applications such as photosensitivity, display materials and combustion promoters. When using and handling, it is necessary to pay attention to safe operation and take corresponding protective measures.
Last Update:2024-04-10 22:29:15