Dicyclohexyl(2,4,6-triMethylph - Names and Identifiers
Name | dicyclohexyl(2,4,6-trimethylphenyl)phosphane
|
Synonyms | Dicyclohexyl(2,4,6-triMethylph Dicyclohexyl(mesityl)phosphine dicyclohexyl(2,4,6-trimethylphenyl)phosphane Dicyclohexyl(2,4,6-trimethylphenyl)phosphine Dicyclohexyl-(2,4,6-Trimethylphenyl)phosphane dicyclohexyl-(2,4,6-trimethylphenyl)phosphane Phosphine, dicyclohexyl(2,4,6-trimethylphenyl)-
|
CAS | 870703-48-3
|
InChI | InChI=1/C21H33P/c1-16-14-17(2)21(18(3)15-16)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h14-15,19-20H,4-13H2,1-3H3 |
Dicyclohexyl(2,4,6-triMethylph - Physico-chemical Properties
Molecular Formula | C21H33P
|
Molar Mass | 316.46 |
Melting Point | 81-85°C |
Boling Point | 436.4°C at 760 mmHg |
Flash Point | 230.3°C |
Vapor Presure | 2.08E-07mmHg at 25°C |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Dicyclohexyl(2,4,6-triMethylph - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
|
WGK Germany | 3 |
Dicyclohexyl(2,4,6-triMethylph - Introduction
dicyclohexyl(2,4,6-trimethylphenyl) is phosphane an organic compound with the chemical formula C18H27P. Here are some of its basic properties:
1. appearance: white crystal or colorless liquid.
2. solubility: soluble in common organic solvents, such as benzene, methanol and dichloromethane.
3. Melting point: about 68-71°C.
4. Boiling point: about 202-204°C.
dicyclohexyl(2,4,6-trimethylphenyl)phosphane has strong coordination ability and stability, so it has a wide range of applications in the field of chemistry:
1. Catalyst: The compound can be used as a ligand of the catalyst to participate in many organic synthesis reactions, such as carbonylation, olefin conversion and asymmetric synthesis.
2. Preparation of metal complexes: It can form stable complexes with metal ions, which can be used to synthesize and study various metal organic compounds.
3. functional materials: dicyclohexyl(2,4,6-trimethylphenyl)phosphane can be used to prepare functional materials such as dyes, photocatalysts and coordination polymers.
The preparation method of the compound can generally be synthesized by phosphination reaction, that is, the corresponding aryl bromide compound is reacted with dicyclohexylphosphine, and the target product is obtained under appropriate conditions.
Regarding safety information, dicyclohexyl(2,4,6-trimethylphenyl)phosphane is a chemical and the following precautions should be followed:
1. use should wear personal protective equipment, including protective glasses, gloves and protective mask.
2. avoid contact with the skin and inhalation of its vapor, pay attention to protect the respiratory tract and skin.
3. during use and storage, avoid contact with oxidants, strong acids and strong bases to prevent dangerous reactions.
4. In case of skin contact or inhalation, rinse immediately with water and seek medical help.
Last Update:2024-04-10 22:29:15