930790-54-8

930790-54-8 - Names and Identifiers

Name	5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine
Synonyms	5-CHLORO-7-METHYL-6-AZAINDOLE 5-Chloro-7-methyl-1H-pyrrolo[2,3-c]pyridine 1H-Pyrrolo[2,3-c]pyridine, 5-chloro-7-methyl- 1H-Pyrrolo[2,3-c]pyridine, 5-chloro-7-Methyl-
CAS	930790-54-8
InChI	InChI=1S/C8H7ClN2/c1-5-8-6(2-3-10-8)4-7(9)11-5/h2-4,10H,1H3

930790-54-8 - Physico-chemical Properties

Molecular Formula	C8H7ClN2
Molar Mass	166.61
Density	1.351±0.06 g/cm3(Predicted)
Boling Point	324.6±37.0 °C(Predicted)
pKa	14.05±0.40(Predicted)

930790-54-8 - Introduction

[2,3-c]pyridine is an organic compound with the chemical formula C9H7ClN2. It is a white crystalline solid with aromaticity.

The following is a detailed description of the properties, uses, preparation and safety information of the compound:

Nature:
1. Appearance: [2,3-c]pyridine is a white crystalline solid.
2. Solubility: Soluble in most organic solvents, such as dimethyl sulfoxide, dichloromethane, etc.
3. melting point: about 70-74 degrees Celsius.

Use:
1. Pharmaceutical use: [2,3-c]pyridine compounds are often used as reagents and synthetic intermediates, and can be used to synthesize various organic compounds with biological activity, such as drugs and pesticides.
2. scientific research purposes: the compound is also often used in scientific research in the field of organic synthesis reaction and drug activity research.

Method:
[2,3-c] There are many methods for preparing pyridine, among which the commonly used methods are as follows:
1. Through the reaction of pyridine and 1,5-dichloropentane, and then with ethyl methacrylate condensation, and finally through a series of steps such as reduction, chlorination reaction to obtain the target product.
2. The target product is synthesized by the reaction of pyridine and 1,5-dichloropentane, and then condensed with chloroethyl methacrylate, and finally by the steps of reduction and chlorination.

Safety Information:
1. [2,3-c]pyridine irritant, avoid direct contact with skin and eyes.
2. in use or handling, need to wear appropriate personal protective equipment, such as laboratory gloves, protective glasses, protective masks.
3. during storage and transportation, keep dry, away from fire and oxidant, and avoid contact with harmful substances such as oxygen and chloride.
4. If taken by mistake or inhaled, immediately seek hospital treatment and provide the doctor with relevant chemical information.

Last Update：2024-04-09 02:00:49