90973-23-2
4-amino-2-piperidino-5-pyrimidinecarbonitrile
CAS: 90973-23-2
Molecular Formula: C10H13N5
90973-23-2 - Names and Identifiers
| Name | 4-amino-2-piperidino-5-pyrimidinecarbonitrile |
| Synonyms | 4-AMINO-2-PIPERIDINO-5-PYRIMIDINECARBONITRILE 4-amino-2-piperidino-5-pyrimidinecarbonitrile 4-AMINO-2-PIPERIDIN-1-YL-PYRIMIDINE-5-CARBONITRILE 4-AMINO-2-(1-PIPERIDINYL)PYRIMIDINE-5-CARBONITRILE |
| CAS | 90973-23-2 |
| InChI | InChI=1/C10H13N5/c11-6-8-7-13-10(14-9(8)12)15-4-2-1-3-5-15/h7H,1-5H2,(H2,12,13,14) |
90973-23-2 - Physico-chemical Properties
| Molecular Formula | C10H13N5 |
| Molar Mass | 203.24 |
| Density | 1.27g/cm3 |
| Melting Point | 224 °C (lit.) |
| Boling Point | 457.1°C at 760 mmHg |
| Flash Point | 230.2°C |
| Vapor Presure | 1.54E-08mmHg at 25°C |
| Refractive Index | 1.615 |
90973-23-2 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
90973-23-2 - Introduction
It is an organic compound with a molecular formula of C12H14N6 and a molecular weight of 250.28g/mol.
Nature:
-Appearance: colorless crystal
-Solubility: Soluble in ethanol, acetone and dimethyl sulfoxide
-melting point: about 130-133 ℃
-Stability: stable under normal conditions, but not stable to light and heat
Use:
frequently used in drug synthesis and pharmaceutical research. It is an intermediate that can be used to synthesize a variety of biologically active compounds, such as anticancer drugs, antiviral drugs, etc.
Method:
The synthesis method can be achieved by the following steps:
1. The reaction of 1-piperidine formaldehyde and sodium hypochlorite generates 1-piperidine methanol.
2. Under certain conditions, 1-piperidine methanol and 2-chloro -4,6-dimethyl pyrimidine cyclization reaction, 4-amino -2-(1-piperidinyl) pyrimidine.
3. In a solvent, 4-amino-2-(1-piperidinyl) pyrimidine and acetonitrile are appropriately reacted to generate bromine.
Safety Information:
-may cause irritation to the eyes, skin and respiratory tract and should be avoided.
-Use appropriate personal protective equipment, such as lab gloves, safety glasses and lab coats.
-Good laboratory safety practices should be observed when storing and handling the compound.
-In the event of accidental exposure or inhalation of the compound, the affected area should be promptly rinsed with water and medical assistance should be sought.
Nature:
-Appearance: colorless crystal
-Solubility: Soluble in ethanol, acetone and dimethyl sulfoxide
-melting point: about 130-133 ℃
-Stability: stable under normal conditions, but not stable to light and heat
Use:
frequently used in drug synthesis and pharmaceutical research. It is an intermediate that can be used to synthesize a variety of biologically active compounds, such as anticancer drugs, antiviral drugs, etc.
Method:
The synthesis method can be achieved by the following steps:
1. The reaction of 1-piperidine formaldehyde and sodium hypochlorite generates 1-piperidine methanol.
2. Under certain conditions, 1-piperidine methanol and 2-chloro -4,6-dimethyl pyrimidine cyclization reaction, 4-amino -2-(1-piperidinyl) pyrimidine.
3. In a solvent, 4-amino-2-(1-piperidinyl) pyrimidine and acetonitrile are appropriately reacted to generate bromine.
Safety Information:
-may cause irritation to the eyes, skin and respiratory tract and should be avoided.
-Use appropriate personal protective equipment, such as lab gloves, safety glasses and lab coats.
-Good laboratory safety practices should be observed when storing and handling the compound.
-In the event of accidental exposure or inhalation of the compound, the affected area should be promptly rinsed with water and medical assistance should be sought.
Last Update：2024-04-09 02:00:49
