Name | 1-benzothiophen-6-yl methyl ether |
Synonyms | 6-Methoxybenzothiophene 6-Methoxy-1-benzothiophen 6-Methoxybenzo(b)thiophene 6-methoxy-1-benzothiophene Benzo[b]thiophene, 6-Methoxy- 1-Benzothiophen-6-yl-methylether 1-benzothiophen-6-yl methyl ether |
CAS | 90560-10-4 |
InChI | InChI=1/C9H8OS/c1-10-8-3-2-7-4-5-11-9(7)6-8/h2-6H,1H3 |
Molecular Formula | C9H8OS |
Molar Mass | 164.22 |
Density | 1.198±0.06 g/cm3(Predicted) |
Melting Point | 38-39 °C |
Boling Point | 153-156 °C(Press: 16 Torr) |
Flash Point | 116.411°C |
Vapor Presure | 0.012mmHg at 25°C |
Storage Condition | 2-8°C(protect from light) |
Refractive Index | 1.637 |
Use | This product is for scientific research only and shall not be used for other purposes. |