Name | methyl 5-hydroxy-2-methylbenzoate |
Synonyms | methyl 5-hydroxy-2-methylbenzoate methyl 3-hydroxy-6-methylbenzoate METHYL-5-METHOXY-2-METHYLBENZOATE 5-Hydroxy-2-Methyl Bezoic Acid Methyl Ester 5-Hydroxy-2-methyl benzoic acid methyl ester benzoic acid, 5-hydroxy-2-methyl-, methyl ester Benzoic acid, 5-hydroxy-2-Methyl-, Methyl ester |
CAS | 73505-48-3 |
InChI | InChI=1/C9H10O3/c1-6-3-4-7(10)5-8(6)9(11)12-2/h3-5,10H,1-2H3 |
Molecular Formula | C9H10O3 |
Molar Mass | 166.18 |
Density | 1.169±0.06 g/cm3(Predicted) |
Melting Point | 75-76 °C(Solv: ethyl acetate (141-78-6); ligroine (8032-32-4)) |
Boling Point | 287.9±20.0 °C(Predicted) |
Flash Point | 124.994°C |
Vapor Presure | 0.001mmHg at 25°C |
pKa | 9.45±0.18(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Sensitive | Irritant |
Refractive Index | 1.542 |
MDL | MFCD11226199 |
Hazard Class | IRRITANT |
Use | Methyl 5-hydroxy-2-methylbenzoate is a more important commonly used drug intermediate, which can be used in organic synthesis and laboratory research and development. |