6-Aminopurine-8(9H) - Names and Identifiers
Name | 6-amino-1,7-dihydro-8H-purine-8-thione
|
Synonyms | Meradine Nsc22721 AI3-50260 NSC 22721 6-Aminopurine-8(9H) 6-Amino-9H-purine-8-thiol 6-Amino-1H-purine-8-thiol 6-Amino-7H-purine-8-thiol 6-Amino-8-mercapto-9H-purine 6-Amino-1,7-dihydro-8H-purine-8-thione 6-amino-1,7-dihydro-8H-purine-8-thione 6-amino-7,9-dihydro-8H-purine-8-thione 8H-Purine-8-thione, 6-amino-1,7-dihydro-
|
CAS | 7390-62-7
|
EINECS | 230-974-4 |
InChI | InChI=1/C5H5N5S/c6-3-2-4(8-1-7-3)10-5(11)9-2/h1H,(H4,6,7,8,9,10,11) |
6-Aminopurine-8(9H) - Physico-chemical Properties
Molecular Formula | C5H5N5S
|
Molar Mass | 167.19 |
Density | 2.08±0.1 g/cm3(Predicted) |
Melting Point | 370-375°C |
Boling Point | 273.3±50.0 °C(Predicted) |
Flash Point | 192.8°C |
Vapor Presure | 1.88E-06mmHg at 25°C |
pKa | 7.23±0.40(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.837 |
6-Aminopurine-8(9H) - Risk and Safety
WGK Germany | 3 |
Hazard Class | IRRITANT |
6-Aminopurine-8(9H) - Introduction
6-amino-1, organic 6-amino-1, is a compound with the following properties:
1. Appearance: 6-amino-1, white crystalline solid.
2. Solubility: low solubility in water, good solubility in organic solvents such as ether and dimethyl sulfoxide.
3. chemical reaction: 6-amino-1, a strong reducing agent, can react with many compounds, such as catechol, nitrobenzene and aromatic aldehydes.
4. use: 6-amino-1, commonly used in organic synthesis and pharmaceutical research, especially as a reducing agent and optical materials raw materials. At the same time, it is also used as a treatment agent in metal ion detection and turf plant nutrition research.
5. preparation method: 6-amino-1, it can form a bond between adenine and sulfur. common synthesis methods include adenine and reducing agent reaction with sulfur source, such as sodium sulfide or sodium thiosulfate.
6. Safety information: There is a lack of detailed research and information on the safety of 6-amino-1. However, as an organic compound, it may be irritating to the skin and eyes, so contact with the skin and eyes should be avoided during use, and the operation should be performed in a well-ventilated area. For any chemical laboratory operation, safe operating procedures should be followed and appropriate personal protective equipment should be used.
Last Update:2024-04-09 21:11:58