Name | 5-NITRO-NAPHTHALENE-1-CARBOXYLIC ACID |
Synonyms | 5-Nitro-1-naphthoic acid 5-NITRO-PHTHALENE-1-CARBOXYLIC ACID 5-Nitronaphthalene-1-carboxylicacid 5-NITRO-NAPHTHALENE-1-CARBOXYLIC ACID 1-naphthalenecarboxylic acid, 5-nitro- |
CAS | 1975-44-6 |
InChI | InChI=1/C11H7NO4/c13-11(14)9-5-1-4-8-7(9)3-2-6-10(8)12(15)16/h1-6H,(H,13,14) |
Molecular Formula | C11H7NO4 |
Molar Mass | 217.18 |
Density | 1.3654 (rough estimate) |
Melting Point | 241.5°C |
Boling Point | 357.72°C (rough estimate) |
Flash Point | 199.2°C |
Vapor Presure | 7.4E-09mmHg at 25°C |
pKa | 2.61±0.10(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.4900 (estimate) |
Uses | 5-nitronaphthalene-1-formic acid is a pharmaceutical intermediate, which can be obtained by nitration of α-naphthoic acid with fuming nitric acid. |