Name | 2-Pyridinamine, 5-bromo-4-chloro- |
Synonyms | 5-BroMo-4-chloro-2-aMinopyri 5-Bromo-4-chloro-2-aminop... 5-bromo-4-chloropyridin-2-amine 5-BroMo-4-chloro-2-aMinopyridine 2-Amino-4-chloro-5-bromopyridine 2-Amino-5-bromo-4-chloroPyridine 2-Pyridinamine, 5-bromo-4-chloro- 5-BroMo-4-chloro-pyridin-2-ylaMine |
CAS | 942947-94-6 |
InChI | InChI=1/C5H4BrClN2/c6-3-2-9-5(8)1-4(3)7/h1-2H,(H2,8,9) |
Molecular Formula | C5H4BrClN2 |
Molar Mass | 207.46 |
Density | 1.834±0.06 g/cm3(Predicted) |
Boling Point | 271.6±35.0 °C(Predicted) |
pKa | 3.61±0.24(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.648 |
Use | 2-amino-4-chloro-5-bromopyridine can be used to synthesize 2, 4-dichloro-5-bromopyridine. 2, 4-dichloro-5-bromopyridine is an important biomedical intermediate, which can be widely used in the synthesis of various drugs. Its small molecular weight, unique structure, can derive a variety of downstream products, with a wide range of uses. |