4,5,9,10-TETRAAZAPHENANTHRENE
dipyrido[3,2-c:2',3'-e]pyridazine
CAS: 653-05-4
Molecular Formula: C10H6N4
4,5,9,10-TETRAAZAPHENANTHRENE - Names and Identifiers
| Name | dipyrido[3,2-c:2',3'-e]pyridazine |
| Synonyms | 4,5,9,10-TETRAAZAPHENANTHRENE 1,5,6,10-Tetraazaphenanthrene 4,5,9,10-Tetraazaphenanthrene 5,6-Diaza-1,10-phenanthroline |
| CAS | 653-05-4 |
| InChI | InChI=1/C10H6N4/c1-3-7-9(11-5-1)10-8(14-13-7)4-2-6-12-10/h1-6H |
4,5,9,10-TETRAAZAPHENANTHRENE - Physico-chemical Properties
| Molecular Formula | C10H6N4 |
| Molar Mass | 182.18 |
| Density | 1.395±0.06 g/cm3(Predicted) |
| Melting Point | 225-230 |
| Boling Point | 395.7°C at 760 mmHg |
| Flash Point | 219.6°C |
| Vapor Presure | 4.11E-06mmHg at 25°C |
| pKa | 0.22±0.30(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.77 |
4,5,9,10-TETRAAZAPHENANTHRENE - Introduction
dipyrido[3,2-c:2 ',3'-e]pyridazine is a heterocyclic compound containing four nitrogen atoms and has the formula C12H6N4. Its properties are as follows:
1. Appearance: dipyrido[3,2-c:2 ',3'-e] was pyridazine as a pale yellow solid.
2. Melting point: It has a higher melting point, about 240-245 degrees Celsius.
3. Solubility: dipyrido[3,2-c:2 ',3'-e]pyridazine has good solubility in common organic solvents.
dipyrido[3,2-c:2 ',3'-e]pyridazine have some important applications and uses, including:
1. As an organic dye: Due to its special molecular structure and light absorption properties, dipyrido[3,2-c:2 ',3'-e]pyridazine can be used as an organic dye for the preparation of dyes and pigments.
2. Optoelectronic devices: dipyrido[3,2-c:2 ',3'-e]pyridazine material properties make it have potential applications in optoelectronic devices, such as organic photoelectric conversion devices and organic light-emitting diodes (OLED), etc.
There are two common methods for preparing dipyrido[3,2-c:2 ',3'-e]pyridazine:
1. Through organic synthesis: Through appropriate organic synthesis routes, dipyrido[3,2-c:2 ',3'-e]pyridazine can be synthesized from suitable starting materials. These synthetic routes may include cyclization reactions, nitrogen atom doping reactions, and the like.
2. Modification by other compounds: In some cases, the dipyrido[3,2-c:2 ',3'-e]pyridazine may be formed in the reaction by modifying or reacting other compounds.
When using and handling dipyrido[3,2-c:2 ',3'-e]pyridazine, the following safety information needs to be noted:
1. Toxicity: dipyrido[3,2-c:2 ',3'-e]pyridazine may cause some adverse effects on human body when inhaled in large quantities or exposed for a long time. Therefore, it is necessary to wear appropriate protective equipment, such as gloves, masks and goggles, when in use.
2. extinguishing agent: when extinguishing fire, appropriate extinguishing agent should be used, such as carbon dioxide, dry powder extinguishing agent, etc.
3. Storage and disposal: dipyrido[3,2-c:2 ',3'-e]pyridazine should be stored in sealed containers, away from ignition and oxidizing agents. When discarded, comply with local waste disposal regulations and treat it as hazardous waste.
Generally speaking, dipyrido[3,2-c:2 ',3'-e]pyridazine is an organic compound with potential applications, but it should be used with caution and follow relevant safety procedures.
1. Appearance: dipyrido[3,2-c:2 ',3'-e] was pyridazine as a pale yellow solid.
2. Melting point: It has a higher melting point, about 240-245 degrees Celsius.
3. Solubility: dipyrido[3,2-c:2 ',3'-e]pyridazine has good solubility in common organic solvents.
dipyrido[3,2-c:2 ',3'-e]pyridazine have some important applications and uses, including:
1. As an organic dye: Due to its special molecular structure and light absorption properties, dipyrido[3,2-c:2 ',3'-e]pyridazine can be used as an organic dye for the preparation of dyes and pigments.
2. Optoelectronic devices: dipyrido[3,2-c:2 ',3'-e]pyridazine material properties make it have potential applications in optoelectronic devices, such as organic photoelectric conversion devices and organic light-emitting diodes (OLED), etc.
There are two common methods for preparing dipyrido[3,2-c:2 ',3'-e]pyridazine:
1. Through organic synthesis: Through appropriate organic synthesis routes, dipyrido[3,2-c:2 ',3'-e]pyridazine can be synthesized from suitable starting materials. These synthetic routes may include cyclization reactions, nitrogen atom doping reactions, and the like.
2. Modification by other compounds: In some cases, the dipyrido[3,2-c:2 ',3'-e]pyridazine may be formed in the reaction by modifying or reacting other compounds.
When using and handling dipyrido[3,2-c:2 ',3'-e]pyridazine, the following safety information needs to be noted:
1. Toxicity: dipyrido[3,2-c:2 ',3'-e]pyridazine may cause some adverse effects on human body when inhaled in large quantities or exposed for a long time. Therefore, it is necessary to wear appropriate protective equipment, such as gloves, masks and goggles, when in use.
2. extinguishing agent: when extinguishing fire, appropriate extinguishing agent should be used, such as carbon dioxide, dry powder extinguishing agent, etc.
3. Storage and disposal: dipyrido[3,2-c:2 ',3'-e]pyridazine should be stored in sealed containers, away from ignition and oxidizing agents. When discarded, comply with local waste disposal regulations and treat it as hazardous waste.
Generally speaking, dipyrido[3,2-c:2 ',3'-e]pyridazine is an organic compound with potential applications, but it should be used with caution and follow relevant safety procedures.
Last Update：2024-04-10 22:29:15
Supplier List
Spot supply
Product Name: ?15610-Tetraazaphenanthrene Visit Supplier Webpage Request for quotationCAS: 653-05-4
Tel: +86 0571-86722205
Email: sales@chinaskyrun.com
Mobile: +8618958170122
QQ: 2531159185
Wechat: chinaskyrun
Product Name: 4,5,9,10-Tetraazaphenanthrene Visit Supplier Webpage Request for quotation
CAS: 653-05-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 653-05-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Spot supply
Product Name: ?15610-Tetraazaphenanthrene Visit Supplier Webpage Request for quotationCAS: 653-05-4
Tel: +86 0571-86722205
Email: sales@chinaskyrun.com
Mobile: +8618958170122
QQ: 2531159185
Wechat: chinaskyrun
Product Name: 4,5,9,10-Tetraazaphenanthrene Visit Supplier Webpage Request for quotation
CAS: 653-05-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 653-05-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
View History
4,5,9,10-TETRAAZAPHENANTHRENE
2-(Ethylamino)atrazine
(S)-1-Benzyl 3-ethyl piperidine-1,3-dicarboxylate
L-Valine,L-alanyl-L-alanyl-(gS,dS)-d-amino-g-hydroxybenzenehexanoyl-L-valyl-, methyl ester
29704-70-9
alpha-Pyridone
1,1'-methylenebis[4-azidobenzene]
BIBF-1120
2-iodo-1,3-dimethoxybenzene
3-(2-Hydroxyphenyl)-2-propenoic acid ethyl ester
2-(Ethylamino)atrazine
(S)-1-Benzyl 3-ethyl piperidine-1,3-dicarboxylate
L-Valine,L-alanyl-L-alanyl-(gS,dS)-d-amino-g-hydroxybenzenehexanoyl-L-valyl-, methyl ester
29704-70-9
alpha-Pyridone
1,1'-methylenebis[4-azidobenzene]
BIBF-1120
2-iodo-1,3-dimethoxybenzene
3-(2-Hydroxyphenyl)-2-propenoic acid ethyl ester