Name | [3-(benzyloxy)-2,6-difluorophenyl]boronic acid |
Synonyms | 3-(Benzyloxy)-2 3-Benzyloxy-2,6-difluorophenylbornic acid 3-(Benzyloxy)-2,6-difluorobenzeneboronic acid [3-(benzyloxy)-2,6-difluorophenyl]boronic acid (2,6-difluoro-3-phenylmethoxyphenyl)boronic acid B-[2,6-Difluoro-3-(phenylmethoxy)phenyl]boronic acid Boronic acid, B-[2,6-difluoro-3-(phenylmethoxy)phenyl]- |
CAS | 870718-07-3 |
InChI | InChI=1/C13H11BF2O3/c15-10-6-7-11(13(16)12(10)14(17)18)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2 |
Molecular Formula | C13H11BF2O3 |
Molar Mass | 264.03 |
Density | 1.32 |
Melting Point | 112-118°C(lit.) |
Boling Point | 439.6±55.0 °C(Predicted) |
Flash Point | 219.6°C |
Vapor Presure | 1.67E-08mmHg at 25°C |
pKa | 7.69±0.58(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.562 |
MDL | MFCD06200705 |
Hazard Symbols | Xi - Irritant![]() |
Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
WGK Germany | 3 |
Hazard Note | Irritant |