Name | 6-Phenyl-2-picoline |
Synonyms | 6-PHENYL-2-PICOLINE 6-Phenyl-2-picoline 2-METHYL-6-PHENYLPYRIDINE 2-Methyl-6-phenylpyridine Pyridine, 2-Methyl-6-phenyl- |
CAS | 46181-30-0 |
EINECS | 256-258-1 |
InChI | InChI=1/C12H11N/c1-10-6-5-9-12(13-10)11-7-3-2-4-8-11/h2-9H,1H3 |
Molecular Formula | C12H11N |
Molar Mass | 169.22 |
Density | 1.0731 g/cm3(Temp: 0 °C) |
Boling Point | 155 °C / 20mmHg |
Flash Point | 109.6°C |
Vapor Presure | 0.0126mmHg at 25°C |
Appearance | clear liquid |
Color | Colorless to Almost colorless |
pKa | 5.16±0.10(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | 1.6080 to 1.6120 |
MDL | MFCD00796537 |
HS Code | 29333990 |