2-Chloro-5-methoxybenzaldehyde

2-Chloro-5-methoxybenzaldehyde - Names and Identifiers

Name	2-Chloro-5-methoxybenzaldehyde
Synonyms	2-Chloro-5-methoxybenzaldehyde 1-(5-fluoro-6-methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-yl-1,2-ethanedione 1-(5-Fluoro-6-Methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridine-6-yl-1,2-ethanedione 1-(5-Fluoro-6-methyl-2-pyridinyl)-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2-ethanedione 1,2-Ethanedione, 1-(5-fluoro-6-Methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-yl- 1-([1,2,4]Triazolo[1,5-a]pyridin-6-yl)-2-(5-fluoro-6-methylpyridin-2-yl)ethane-1,2-dione
CAS	943442-82-8
InChI	InChI=1S/C14H9FN4O2/c1-8-10(15)3-4-11(18-8)14(21)13(20)9-2-5-12-16-7-17-19(12)6-9/h2-7H,1H3

2-Chloro-5-methoxybenzaldehyde - Physico-chemical Properties

Molecular Formula	C14H9FN4O2
Molar Mass	284.25
Storage Condition	2-8°C

2-Chloro-5-methoxybenzaldehyde - Introduction

It is also known as an organic compound.

Nature:
-Appearance: White crystalline solid.
-Molecular formula: C15H10ClFN3O3.
-Molecular weight: 341.71g/mol.
-Melting point: 173-176°C.
-Solubility: Soluble in most organic solvents.

Use:
-As a chemical synthesis intermediate, used in the synthesis of other organic compounds.
-Used in drug development and pesticide research.

Method:
The method of preparing this compound is generally through chemical synthesis, and the specific steps may include the following steps:
1. Use appropriate reaction conditions to synthesize.
2. Synthesized by chemical reaction.

Safety Information:
-The compound should be stored in a sealed container, away from fire and high temperature.
-Use the process should wear appropriate protective gloves and glasses, avoid direct contact with the skin and eyes.
-Correct laboratory safety practices and operating procedures should be followed during handling and handling.
-If it gets into your eyes or inhales, rinse immediately with plenty of water and seek medical attention.

Last Update：2024-04-09 02:00:49