Name | 4-Chlorobenzyl 2-hydroxyethyl sulphide |
Synonyms | 2-p-chlorobenzylthioethanol 2-(4-Chlorobenzylthio)ethanol 2-(p-chlorobenzylthio)-ethano 2-[(4-chlorobenzyl)sulfanyl]ethanol P-CHLOROBENZYL 2-HYDROXYETHYL SULFIDE 4-CHLOROBENZYL 2-HYDROXYETHYL SULFIDE 4-CHLOROBENZYL 2-HYDROXYETHYL SULPHIDE 4-Chlorobenzyl 2-hydroxyethyl sulphide 2-[[(4-chlorophenyl)methyl]thio]ethanol 2-[(4-chlorophenyl)methylsulfanyl]ethanol |
CAS | 71501-40-1 |
EINECS | 275-568-8 |
InChI | InChI=1/C9H11ClOS/c10-9-3-1-8(2-4-9)7-12-6-5-11/h1-4,11H,5-7H2 |
Molecular Formula | C9H11ClOS |
Molar Mass | 202.7 |
Density | 1.249±0.06 g/cm3(Predicted) |
Boling Point | 139-140°C 1mm |
Flash Point | 139-140°C/1mm |
Vapor Presure | 7.76E-05mmHg at 25°C |
BRN | 8975850 |
pKa | 14.45±0.10(Predicted) |
Refractive Index | 1.5855 |
Safety Description | S24/25 - Avoid contact with skin and eyes. |
RTECS | KK1150000 |