Name | 2,6-Dichloropurine riboside |
Synonyms | 2,6-Dichloropurine r 2,6-dichloropuine nuceotide 2,6-Dichloropurine riboside 2, 6-DICHLOROPURINE RIBOSIDE (2,6DClPR) 2,6-dichloro-9-pentofuranosyl-9H-purine 2,6-dichloro-9-(β-D-ribofuranosyl)purine 2,6-Dichloro-9-β-D-ribofuranosyl-9H-purine 2,6-Dichloro-9-(beta-D-ribofuranosyl)purine (2R,3R,4S,5R)-2-(2,6-Dichloro-9H-purin-9-yl)-5-(hydroxyMethyl)tetrahydrofuran-3,4-diol |
CAS | 13276-52-3 |
EINECS | 1308068-626-2 |
InChI | InChI=1/C10H10Cl2N4O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2 |
Molecular Formula | C10H10Cl2N4O4 |
Molar Mass | 321.12 |
Density | 2.14±0.1 g/cm3(Predicted) |
Melting Point | >190°C (dec) |
Boling Point | 542.2±60.0 °C(Predicted) |
Flash Point | 310.2°C |
Solubility | DMSO (Slightly), Methanol (Slightly), Water |
Vapor Presure | 9.86E-15mmHg at 25°C |
Appearance | White to off-white solid |
Color | White to Off-White |
pKa | 13.00±0.70(Predicted) |
Storage Condition | Inert atmosphere,2-8°C |
Refractive Index | 1.854 |