2,4-Diaminopyrimidine-5-carbonitrile - Names and Identifiers
Name | 2,4-DIAMINOPYRIMIDINE-5-CARBONITRILE
|
Synonyms | NSC 135235 2,4-DIAMINO-5-CYANO-PYRIMIDINE 2,4-Diaminopyrimidine-5-carbonitriL 2,4-DIAMINO-5-PYRIMIDINECARBONITRILE 2,4-DIAMINOPYRIMIDINE-5-CARBONITRILE 2,4-Diaminopyrimidine-5-carbonitrile 5-Pyrimidinecarbonitrile, 2,4-diamino- 5-Pyrimidinecarbonitrile, 2,4-diamino- (6CI,8CI,9CI)
|
CAS | 16462-27-4
|
InChI | InChI=1/C5H5N5/c6-1-3-2-9-5(8)10-4(3)7/h2H,(H4,7,8,9,10) |
2,4-Diaminopyrimidine-5-carbonitrile - Physico-chemical Properties
Molecular Formula | C5H5N5
|
Molar Mass | 135.13 |
Density | 1.45±0.1 g/cm3(Predicted) |
Melting Point | 318 °C (decomp) |
Boling Point | 498.2±55.0 °C(Predicted) |
Flash Point | 255.1°C |
Solubility | DMF (Slightly, Heated), DMSO (Slightly) |
Vapor Presure | 4.62E-10mmHg at 25°C |
Appearance | Solid |
Color | Light Yellow |
pKa | 3.93±0.10(Predicted) |
Storage Condition | Keep in dark place,Sealed in dry,2-8°C |
Refractive Index | 1.658 |
2,4-Diaminopyrimidine-5-carbonitrile - Risk and Safety
2,4-Diaminopyrimidine-5-carbonitrile - Introduction
(2, 2) is an organic compound with the chemical formula C4H4N6, which contains two amino groups and a nitrile group in its structure.
This compound has the following important properties:
1. Physical Properties: 2. It is a white crystalline solid with a high melting point and boiling point.
2. Chemical Properties: 2. The solubility in water is low, but it can be dissolved in some organic solvents. It belongs to a weak alkaline substance, in aqueous solution can react with acid to generate salt compounds.
In practical applications, 2. It has some important uses:
1. Pharmaceutical field: 2. It is an important intermediate compound that can be used to synthesize a series of drugs, especially some anti-cancer drugs.
2. Pesticide field: 2. It is also used to synthesize certain pesticides, such as herbicides or insecticides.
Preparation 2, usually can be carried out by the following methods:
1. Synthesis Method 1: Under appropriate temperature and reaction conditions, an appropriate amount of 2,4-diaminopyrimidine is reacted with cyanide to obtain the target product.
2. Synthesis Method 2: By chemically modifying other functional groups of 2,4-diaminopyrimidine, the functional groups are then converted into nitrile groups.
safety information, 2, for hazardous substances, has a certain toxicity. During use and storage, care should be taken to avoid inhalation of dust and contact with skin or eyes. Wear appropriate personal protective equipment to ensure a well-ventilated working environment. In the event of accidental contact, immediately flush the affected area with clean water and seek medical attention.
Last Update:2024-04-09 20:11:46