183274-50-2
3-Bromo-4-isopropoxy-1H-pyrazolo[3,4-d]pyrimidin-6-amine
CAS: 183274-50-2
Molecular Formula: C8H10BrN5O
183274-50-2 - Names and Identifiers
| Name | 3-Bromo-4-isopropoxy-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
| Synonyms | 3-Bromo-4-isopropoxy-1H-pyrazolo[3,4-d]pyrimidin-6-amine 3-BroMo-4-isopropoxy-1H-pyrazolo[3,4-d]pyriMidin-6-aMine 3-bromo-4-propan-2-yloxy-2h-pyrazolo[3,4-d]pyrimidin-6-amine 3-Bromo-4-(propan-2-yloxy)-1H-pyrazolo[3,4-d]pyrimidin-6-amine 1H-Pyrazolo[3,4-d]pyrimidin-6-amine, 3-bromo-4-(1-methylethoxy)- 1H-Pyrazolo[3,4-d]pyriMidin-6-aMine, 3-broMo-4-(1-Methylethoxy)- |
| CAS | 183274-50-2 |
| InChI | InChI=1S/C8H10BrN5O/c1-3(2)15-7-4-5(9)13-14-6(4)11-8(10)12-7/h3H,1-2H3,(H3,10,11,12,13,14) |
183274-50-2 - Physico-chemical Properties
| Molecular Formula | C8H10BrN5O |
| Molar Mass | 272.1 |
183274-50-2 - Introduction
[3,4-d]pyrimidin-6-amine, often abbreviated as Br-MEP-PAP, is an organic compound. The following is a detailed description of its nature, use, formulation and safety information:
Nature:
-Appearance: Br-MEP-PAP is a solid, the common form is white crystal or powder.
-Melting point: The melting point of the Br-MEP-PAP is between 180-185°C.
-Solubility: It has a certain solubility and can be dissolved in organic solvents, such as dimethyl sulfoxide (DMSO), acetonitrile (ACN), etc.
-Chemical properties: Br-MEP-PAP is an organic compound with complex functional groups, which can be used as a ligand to participate in the synthesis of metal complexes.
Use:
- Br-MEP-PAP are mainly used as ligands of coordination compounds and play an important role in the fields of organometallic chemistry and coordination chemistry.
-it can be used as one of the catalyst catalyst, participate in organic synthesis reaction.
- Br-MEP-PAP can also be used to construct organic molecules with specific structures and properties.
Method:
- Br-MEP-PAP preparation methods are diverse, and common synthetic routes involve a series of chemical reaction steps. Specific preparation methods need to refer to the relevant scientific literature or patent documents.
Safety Information:
- Br-MEP-PAP are organic compounds that may pose a certain risk to the human body or the environment.
-Use should strictly comply with laboratory safety practices and wear appropriate personal protective equipment, such as lab gloves, lab glasses, etc.
-Avoid contact with combustibles or oxidants during storage and operation.
- Br-MEP-PAP detailed safety information should be obtained by consulting the relevant chemical safety data sheet (SDS).
Nature:
-Appearance: Br-MEP-PAP is a solid, the common form is white crystal or powder.
-Melting point: The melting point of the Br-MEP-PAP is between 180-185°C.
-Solubility: It has a certain solubility and can be dissolved in organic solvents, such as dimethyl sulfoxide (DMSO), acetonitrile (ACN), etc.
-Chemical properties: Br-MEP-PAP is an organic compound with complex functional groups, which can be used as a ligand to participate in the synthesis of metal complexes.
Use:
- Br-MEP-PAP are mainly used as ligands of coordination compounds and play an important role in the fields of organometallic chemistry and coordination chemistry.
-it can be used as one of the catalyst catalyst, participate in organic synthesis reaction.
- Br-MEP-PAP can also be used to construct organic molecules with specific structures and properties.
Method:
- Br-MEP-PAP preparation methods are diverse, and common synthetic routes involve a series of chemical reaction steps. Specific preparation methods need to refer to the relevant scientific literature or patent documents.
Safety Information:
- Br-MEP-PAP are organic compounds that may pose a certain risk to the human body or the environment.
-Use should strictly comply with laboratory safety practices and wear appropriate personal protective equipment, such as lab gloves, lab glasses, etc.
-Avoid contact with combustibles or oxidants during storage and operation.
- Br-MEP-PAP detailed safety information should be obtained by consulting the relevant chemical safety data sheet (SDS).
Last Update：2024-04-09 02:00:43
