Name | 3-(4-BROMOPHENYL)PYRIDINE |
Synonyms | 3-(4-BROMOPHENYL)PYRIDINE Pyridine, 3-(4-bromophenyl)- pyridine, 3-(4-bromophenyl)- 1-bromo-4-(pyridin-3-yl)-benzene |
CAS | 129013-83-8 |
EINECS | 807-991-6 |
InChI | InChI=1/C11H8BrN/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10/h1-8H |
Molecular Formula | C11H8BrN |
Molar Mass | 234.09 |
Density | 1.426±0.06 g/cm3(Predicted) |
Melting Point | 38.0 to 42.0 °C |
Boling Point | 331.9±17.0 °C(Predicted) |
Flash Point | 154.5°C |
Vapor Presure | 0.000291mmHg at 25°C |
pKa | 4.70±0.10(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | 1.606 |
use | 3-(4-bromophenyl) pyridine is used in laboratory research and development and chemical and pharmaceutical synthesis. |