1-Fluoro-2,4-Dimethoxybenzene - Names and Identifiers
Name | 2,4-Dimethoxy-1-Fluorobenzene
|
Synonyms | 4-Fluoro-3-Methoxyanisole 4-FLUORO-3-METHOXYANISOLE 2,4-Dimethoxyfluorobenzene 1-Fluoro-2,4-Dimethoxybenzene 1,3-Dimethoxy-4-fluorobenzene 2,4-Dimethoxy-1-Fluorobenzene 2,4-DIMETHOXY-1-FLUOROBENZENE 4-Fluoro-1,3-dimethoxybenzene 1-fluoro-2,4-dimethoxybenzene Benzene, 1-fluoro-2,4-dimethoxy- Benzene, 1-Fluoro-2,4-Dimethoxy-
|
CAS | 17715-70-7
|
InChI | InChI=1/C8H9FO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
1-Fluoro-2,4-Dimethoxybenzene - Physico-chemical Properties
Molecular Formula | C8H9FO2
|
Molar Mass | 156.15 |
Density | 1.188g/mLat 25℃ |
Boling Point | 68-70°C/1mm |
Flash Point | 105°C |
Vapor Presure | 0.161mmHg at 25°C |
Appearance | Liquid |
Color | Pale yellow |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.51 |
Physical and Chemical Properties | Storage Conditions: Keep Cold |
1-Fluoro-2,4-Dimethoxybenzene - Risk and Safety
Risk Codes | 22 - Harmful if swallowed
|
WGK Germany | 3 |
Hazard Class | IRRITANT, KEEP COLD |
1-Fluoro-2,4-Dimethoxybenzene - Introduction
2, is an organic compound with the chemical formula C8H9FO2. The following is an introduction to some of the properties, uses, methods and safety information about 2:
Nature:
-Appearance: 2, colorless to pale yellow liquid.
-Solubility: It can be dissolved in organic solvents, such as ethanol and dimethylformamide.
-Melting point and boiling point: 2. The melting point of the pill is about -14 ° C, and the boiling point is about 160-163 ° C.
-Stability: It is stable at room temperature, but should avoid contact with strong oxidants and strong acids.
Use:
-Chemical reagents: 2. It is often used as raw materials and reagents in organic synthesis and can be used to synthesize other organic compounds.
-Drug synthesis: It also has certain applications in the field of drug synthesis, and can be used to prepare intermediates for certain drugs.
Method:
2. There are many preparation methods for fluorination. One of the commonly used methods is synthesis by fluorination of Methyl phenyl ether. The specific steps are as follows:
1. Dissolve methyl phenyl ether in a suitable solvent.
2. Adding fluorinating agent, such as hydrogen fluoride or metal fluoride.
3. The reaction is carried out under appropriate reaction conditions, such as controlling temperature and reaction time.
4. The product is obtained by filtration and can be subjected to necessary purification steps.
Safety Information:
- 2, which is an organic compound, should generally be handled in accordance with laboratory safety practices and avoid direct contact with skin, eyes or mouth.
-When using or preparing 2, prepare appropriate personal protective equipment, such as laboratory gloves, glasses and protective clothing.
-If contact or ingestion occurs, clean the affected area immediately and seek medical attention.
Last Update:2024-04-09 02:00:43