1-(6-Methoxy-3-pyridinyl)ethanone
1-(6-methoxypyridin-3-yl)ethanone
CAS: 213193-32-9
Molecular Formula: C8H9NO2
1-(6-Methoxy-3-pyridinyl)ethanone - Names and Identifiers
| Name | 1-(6-methoxypyridin-3-yl)ethanone |
| Synonyms | 5-Acetyl-2-methoxypyridine 1-(6-methoxypyridin-3-yl)ethanone 1-(6-Methoxy-3-pyridinyl)ethanone 1-(6-Methoxy-pyridin-3-yl)-ethanone Ethanone, 1-(6-methoxy-3-pyridinyl)- 1-(6-Methoxypyridin-3-yl)ethan-1-one Ethanone, 1-(6-methoxy-3-pyridinyl)- (9CI) |
| CAS | 213193-32-9 |
| InChI | InChI=1/C8H9NO2/c1-6(10)7-3-4-8(11-2)9-5-7/h3-5H,1-2H3 |
1-(6-Methoxy-3-pyridinyl)ethanone - Physico-chemical Properties
| Molecular Formula | C8H9NO2 |
| Molar Mass | 151.16 |
| Density | 1.093±0.06 g/cm3(Predicted) |
| Melting Point | 53-57 °C (lit.) |
| Boling Point | 269.5±20.0 °C(Predicted) |
| Flash Point | 116.791°C |
| Vapor Presure | 0.007mmHg at 25°C |
| Appearance | Solid |
| Color | White to yellow |
| pKa | 1.60±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.506 |
| MDL | MFCD05664350 |
1-(6-Methoxy-3-pyridinyl)ethanone - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
1-(6-Methoxy-3-pyridinyl)ethanone - Introduction
1-(6-methoxypyridin-3-yl)ethanone (1-(6-methoxypyridin-3-yl)ethanone) is an organic compound with the chemical formula C9H11NO2.
Its properties include:
1. Appearance: A colorless to yellow crystalline solid.
2. Solubility: Soluble in organic solvents such as chloroform, ethanol and ether, insoluble in water.
The main uses of 1-(6-methoxypyridin-3-yl)ethanone are:
1. Synthetic intermediate: It can be used as an intermediate for the synthesis of other organic compounds, such as drugs, pesticides, spices and dyes.
2. Drug research: It is often used in the field of drug research, such as raw materials for the synthesis of antibiotics and anti-cancer drugs.
3. Chemical research: It can also be used in organic synthesis reactions, such as alkylation reactions and Suzuki coupling reactions.
The preparation method can generally be obtained through the following steps:
1. First, 2-ethylacetate is reacted with 3-chloromethylpyridine to obtain 5-acetyl-2-methylpyridine.
2. Next, 5-acetyl-2-methylpyridine was reacted with methanol to obtain 1-(6-methoxypyridin-3-yl)ethanone.
Regarding safety information, the specific hazards of 1-(6-methoxypyridin-3-yl)ethanone have not been clearly studied and reported. However, as an organic compound, the following safety measures should generally be noted:
1. Avoid inhalation, ingestion or skin contact, use should wear appropriate personal protective equipment.
2. In use should be under good ventilation conditions.
3. Store in a dry, cool, well-ventilated place, away from fire and oxidant.
4. Avoid contact with incompatible substances such as strong oxidants, acidic substances and combustibles.
Its properties include:
1. Appearance: A colorless to yellow crystalline solid.
2. Solubility: Soluble in organic solvents such as chloroform, ethanol and ether, insoluble in water.
The main uses of 1-(6-methoxypyridin-3-yl)ethanone are:
1. Synthetic intermediate: It can be used as an intermediate for the synthesis of other organic compounds, such as drugs, pesticides, spices and dyes.
2. Drug research: It is often used in the field of drug research, such as raw materials for the synthesis of antibiotics and anti-cancer drugs.
3. Chemical research: It can also be used in organic synthesis reactions, such as alkylation reactions and Suzuki coupling reactions.
The preparation method can generally be obtained through the following steps:
1. First, 2-ethylacetate is reacted with 3-chloromethylpyridine to obtain 5-acetyl-2-methylpyridine.
2. Next, 5-acetyl-2-methylpyridine was reacted with methanol to obtain 1-(6-methoxypyridin-3-yl)ethanone.
Regarding safety information, the specific hazards of 1-(6-methoxypyridin-3-yl)ethanone have not been clearly studied and reported. However, as an organic compound, the following safety measures should generally be noted:
1. Avoid inhalation, ingestion or skin contact, use should wear appropriate personal protective equipment.
2. In use should be under good ventilation conditions.
3. Store in a dry, cool, well-ventilated place, away from fire and oxidant.
4. Avoid contact with incompatible substances such as strong oxidants, acidic substances and combustibles.
Last Update：2024-04-09 21:01:54
Supplier List
Spot supply
Product Name: 5-Acetyl-2-methoxypyridine Visit Supplier Webpage Request for quotationCAS: 213193-32-9
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: 5-Acetyl-2-methoxypyridine Visit Supplier Webpage Request for quotationCAS: 213193-32-9
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: 5-Acetyl-2-methoxypyridine Visit Supplier Webpage Request for quotationCAS: 213193-32-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Spot supply
Product Name: 5-Acetyl-2-methoxypyridine Visit Supplier Webpage Request for quotationCAS: 213193-32-9
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: 5-Acetyl-2-methoxypyridine Visit Supplier Webpage Request for quotationCAS: 213193-32-9
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: 5-Acetyl-2-methoxypyridine Visit Supplier Webpage Request for quotationCAS: 213193-32-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
View History