Name | 1-(4-chloropyridin-2-yl)piperazine |
Synonyms | 1-(4-chloro-2-pyridyl)piperazine 1-(4-Chloro-2-pyridinyl)piperazine 1-(4-chloropyridin-2-yl)piperazine 1-(4-CHLORO-PYRIDIN-2-YL)-PIPERAZINE Piperazine, 1-(4-chloro-2-pyridinyl)- piperazine, 1-(4-chloro-2-pyridinyl)- |
CAS | 885277-30-5 |
InChI | InChI=1/C9H12ClN3/c10-8-1-2-12-9(7-8)13-5-3-11-4-6-13/h1-2,7,11H,3-6H2 |
Molecular Formula | C9H12ClN3 |
Molar Mass | 197.66 |
Density | 1.213±0.06 g/cm3(Predicted) |
Boling Point | 354.8±37.0 °C(Predicted) |
Flash Point | 168.398°C |
Vapor Presure | 0mmHg at 25°C |
pKa | 8.49±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.561 |
Use | 1-(4-chloropyridine)-2-piperazine can be used as a pharmaceutical synthesis intermediate, useful for the preparation of sigma-2 receptor binders and mGlu receptor modulators. |
Application | 1-(4-chloropyridine)-2-piperazine is a pharmaceutical intermediate, it can be used to prepare a PAR-1 antagonist containing the structure of a halogenated pyridyl group and the like. |