1,6-Naphthyridin-5-Amine1,6naphthyridin5amine - Names and Identifiers
Name | 1,6-Naphthyridin-5-amine
|
Synonyms | 1,6phthyridin-5-ylamine 1,6-Naphthyridin-5-aMine 1,6-Naphthyridin-5-amine 5-Amino-1,6-naphthyridine [1,6]Naphthyridin-5-ylaMine 1,6-Naphthyridin-5-Amine
1,6naphthyridin5amine
|
CAS | 55570-60-0
|
InChI | InChI=1S/C8H7N3/c9-8-6-2-1-4-10-7(6)3-5-11-8/h1-5H,(H2,9,11) |
1,6-Naphthyridin-5-Amine1,6naphthyridin5amine - Physico-chemical Properties
Molecular Formula | C8H7N3
|
Molar Mass | 145.16 |
Density | 1.292±0.06 g/cm3(Predicted) |
Boling Point | 343.3±27.0 °C(Predicted) |
pKa | 5.54±0.30(Predicted) |
Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
1,6-Naphthyridin-5-Amine1,6naphthyridin5amine - Introduction
1,6-Naphthyridin-5-amine(1,6-Naphthyridin-5-amine) is an organic compound with the following properties:
1. appearance and state of matter: 1,6-Naphthyridin-5-amine is a solid, the common form is white to light yellow crystal.
2. Solubility: 1,6-Naphthyridin-5-amine is soluble in common solvents, such as dimethyl sulfoxide and dimethyl formamide. Its solubility in water is low.
3. chemical properties: 1,6-Naphthyridin-5-amine is a basic compound, which can react with acid to form salt. It can also undergo condensation reactions with other compounds to form new compounds.
The main uses of 1,6-Naphthyridin-5-amine include:
1. Pharmaceutical field: 1,6-Naphthyridin-5-amine is an important intermediate that can be used to synthesize various drugs, such as antitumor drugs and antiviral drugs.
2. Pesticide field: 1,6-Naphthyridin-5-amine can also be used to synthesize pesticides and has the effect of preventing and controlling plant diseases.
The method of preparing 1,6-Naphthyridin-5-amine is usually achieved by chemical synthesis. A common preparation method is to use 1,6-naphthalic anhydride and carbamate as raw materials and react under suitable reaction conditions.
Regarding safety information, 1,6-Naphthyridin-5-amine is a chemical product, and the following safety precautions should be noted:
1. Wear appropriate personal protective equipment, such as lab gloves, glasses and protective clothing.
2. avoid contact with skin, eyes and respiratory tract, such as accidental contact, should immediately rinse with plenty of water.
3. During handling and storage, proper protective measures should be taken to avoid contact with fire and high temperature environment.
4. During use and disposal, comply with relevant national and local regulations and regulations to ensure safe operation.
this information for reference, the specific use and handling should be combined with the actual situation and the relevant laboratory guidelines to operate.
Last Update:2024-04-09 20:02:46