1,3-DICHLORO-2,4-DIFLUOROBENZENE - Names and Identifiers
Name | 1,3-Dichloro-2,4-difluorobenzene
|
Synonyms | 1,2-dichloro-3-fluorobenzene 1,3-Dichloro-2,4-difluorobenzene 1,3-DICHLORO-2,4-DIFLUOROBENZENE Benzene, 1,3-dichloro-2,4-difluoro-
|
CAS | 36556-37-3
|
InChI | InChI=1/C6H2Cl2F2/c7-3-1-2-4(9)5(8)6(3)10/h1-2H |
1,3-DICHLORO-2,4-DIFLUOROBENZENE - Physico-chemical Properties
Molecular Formula | C6H2Cl2F2
|
Molar Mass | 182.98 |
Density | 1.502 |
Boling Point | 181℃ |
Flash Point | 64℃ |
Vapor Presure | 1.21mmHg at 25°C |
Storage Condition | 2-8°C |
Refractive Index | 1.503 |
Physical and Chemical Properties | |
1,3-DICHLORO-2,4-DIFLUOROBENZENE - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Hazard Note | Irritant |
1,3-DICHLORO-2,4-DIFLUOROBENZENE - Introduction
1,3-Dichloro-2,4-difluorobenzene(1,3-Dichloro-2,4-difluorobenzene) is an organic compound with the chemical formula C6H2Cl2F2. Its main properties are as follows:
1. Appearance: 1,3-Dichloro-2,4-difluorobenzene is a colorless or slightly yellow liquid.
2. Boiling point: The boiling point of the compound is 143-144 degrees Celsius.
3. density: its density is 1.556 g/ml.
4. Solubility: 1,3-Dichloro-2,4-difluorobenzene is soluble in organic solvents such as chloroform, ether, acetone, etc., but is almost insoluble in water.
The main uses of this compound are as follows:
1. Industry: 1,3-Dichloro-2,4-difluorobenzene can be used as an intermediate in organic synthesis for the production of pesticides, drugs, dyes, etc.
2. Research: It can also be used as a reagent for organic synthesis reactions in the laboratory, and has certain application value in organic synthesis experiments.
1,3-Dichloro-2,4-difluorobenzene can be prepared by reacting 2,4-difluorochlorobenzene with chlorine gas. First, 2,4-difluorochlorobenzene was charged into a reaction vessel, and chlorine gas was introduced to maintain the reaction temperature below 100 degrees Celsius. With the passage of chlorine, the chlorine in the reaction solution will undergo an exchange reaction to generate 1,3-Dichloro-2,4-difluorobenzene.
Regarding safety information, 1,3-Dichloro-2,4-difluorobenzene requires the following:
1 toxicity: the compound on the skin, eyes and respiratory tract irritation, should avoid direct contact.
2. Fire and explosion: 1,3-Dichloro-2,4-difluorobenzene is a flammable liquid that can cause fire or explosion under high temperature or open flame conditions. To avoid contact with open flames, it is necessary to operate in a well-ventilated area.
3. Storage and handling: The compound should be stored in a cool, well-ventilated place, away from fire and incompatible substances. Appropriate protective equipment should be worn during handling to avoid direct inhalation of its vapors or contact with the skin.
Last Update:2024-04-09 21:21:28