![]() | |
| Supplier Name | Anhui Royal Chemical Co.,Ltd. |
| Contact | Zhu |
| Tel | +86 02586655873 |
| Mobile | 02586655873 |
| marketing@royal-chem.com | |
| Website | www.royal-chem.com |
| Product Name | Oxalyl chloride |
| Synonyms | Oxaloylchloride OXALYL CHLORIDE Oxalyl chloride Oxalicdichloride Oxaloyl chloride oxalicdichloride Oxaloyl Chloride |
| CAS | 79-37-8 |
| EINECS | 201-200-2 |
| Chemical Formula | C2Cl2O2 |
| Molecular Weight | 126.93 |
| inchi | InChI=1/C2Cl2O2/c3-1(5)2(4)6 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | Oxalyl chloride is not only the intermediate of benzoylurea insecticides such as flumuron and Chlorsulfuron, but also the intermediate of sulfonylurea herbicides Metsulfuron methyl, bensulfuron methyl and pyrazosulfuron methyl. In addition, it can also be used in medicine as raw materials for the synthesis of antibiotics |
| Supplier Website | |
| Last Update | 2026-02-12 09:44:44 |