![]() | |
| Supplier Name | Anhui Royal Chemical Co.,Ltd. |
| Contact | Zhu |
| Tel | +86 02586655873 |
| Mobile | 02586655873 |
| marketing@royal-chem.com | |
| Website | www.royal-chem.com |
| Product Name | Isophthalic acid |
| Synonyms | M-PHTHALIC ACID m-Phthalic acid Isophthalic acid 1,3-phthalicacid m-Dicarboxybenzene RARECHEM AL BO 0036 1,3-dicarboxybenzene |
| CAS | 121-91-5 |
| EINECS | 204-506-4 |
| Chemical Formula | C8H6O4 |
| Molecular Weight | 166.13 |
| inchi | InChI=1/C8H6O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | Isophthalic acid is mainly used in the production of unsaturated polyester resin, pet copolymer and alkyd resin |
| Supplier Website | |
| Last Update | 2026-02-12 09:44:44 |