![]() | |
| Supplier Name | Anhui Royal Chemical Co.,Ltd. |
| Contact | Zhu |
| Tel | +86 02586655873 |
| Mobile | 02586655873 |
| marketing@royal-chem.com | |
| Website | www.royal-chem.com |
| Product Name | 4-Chlorobenzaldehyde |
| Synonyms | PCAD 4-Chlorobenzaldehyde P-CHLOROBENZALDEHYDE p-Chlorobenzaldehyde p-chloro-benzaldehyd benzaldehyde,-chloro- 4-Chloro Benzaldehyde |
| CAS | 104-88-1 |
| EINECS | 203-247-4 |
| Chemical Formula | C7H5ClO |
| Molecular Weight | 140.57 |
| inchi | InChI=1/C7H5ClO/c8-7-3-1-6(5-9)2-4-7/h1-5H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | P-chlorobenzaldehyde is the intermediate of fungicide tebuconazole, plant growth regulator Uniconazole, and insecticide chlorfenapyr. It is also used as the intermediate of fenalutamide, phenylamino acid and dye in medicine. |
| Supplier Website | |
| Last Update | 2026-02-12 09:44:44 |