| Name | 3-quinolylamine |
| Synonyms | 3-AminoquinoL 3-QUINOLINAMINE 3-Quinolylamine 3-quinolylamine 3-amino-quinolin quinolin-3-amine 3-Aminoquinoline 3-Quinolineamine 3-AMINOQUINOLINE Quinoline, 3-amino- TIMTEC-BB SBB004125 |
| CAS | 580-17-6 |
| EINECS | 209-455-1 |
| InChI | InChI=1/C9H8N2/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-6H,10H2 |
| Molecular Formula | C9H8N2 |
| Molar Mass | 144.17 |
| Density | 1.1148 (estimate) |
| Melting Point | 91-92°C(lit.) |
| Boling Point | 137 °C / 1mmHg |
| Flash Point | 167.8°C |
| Water Solubility | slightly soluble in hot water |
| Solubility | methanol: 0.1g/mL, clear |
| Vapor Presure | 0.000565mmHg at 25°C |
| Appearance | Crystalline Powder or Crystals |
| Color | White to beige |
| BRN | 113317 |
| pKa | 4.91(at 20℃) |
| Storage Condition | Store below +30°C. |
| Sensitive | Air Sensitive |
| Refractive Index | 1.7080 (estimate) |
| Risk Codes | R36/38 - Irritating to eyes and skin. R68 - Possible risk of irreversible effects R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S22 - Do not breathe dust. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| RTECS | VA9622000 |
| FLUKA BRAND F CODES | 2-10 |
| TSCA | Yes |
| HS Code | 29334990 |
| Hazard Class | IRRITANT |
| Toxicity | mma-sat 5 mmol/plate MUREAV 187,191,87 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | a fluorescently labeled glycan containing a free reducing end. Together with 4-HCCA and glycerol, a liquid complex matrix for the analysis of neutral and acidic glycans is formed. |
| category | toxic substances |
| toxicity grade | high toxicity |
| Acute toxicity | intraperitoneal-mouse LD50: 150 mg/kg; Intravenous-mouse LD50: 180 mg/kg |
| flammability hazard characteristics | open flame flammable; High heat releases toxic nitrogen oxide gas |
| storage and transportation characteristics | The warehouse is ventilated and dried at low temperature, separate storage of food additives |
| extinguishing agent | dry powder, foam, carbon dioxide, sand, water mist. |