| Name | (+|-)-nornicotine |
| Synonyms | DL-NORNICOTINE NORNICOTINE, DL- (R,S)-NORNICOTINE beta-dl-nornicotine 2-[3-PYRIDYL]PYRROLIDINE (+-)-1'-demethylnicotine 3-PYRROLIDIN-2-YLPYRIDINE 3-(2-Pyrrolidinyl)Pyridine 2-(3-Pyridinyl)pyrrolidine 3-(pyrrolidin-2-yl)pyridine (2S)-2-pyridin-3-ylpyrrolidinium 1-hexopyranuronosyl-3-(1-methyl-5-oxopyrrolidin-2-yl)pyridinium |
| CAS | 5746-86-1 |
| EINECS | 637-353-0 |
| InChI | InChI=1/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/p+1/t9-/m0/s1 |
| Molecular Formula | C9H12N2 |
| Molar Mass | 148.21 |
| Density | 1,074 g/cm3 |
| Melting Point | 235-236 °C(Solv: ethanol (64-17-5)) |
| Boling Point | 107-108°C 2mm |
| Flash Point | 101°C |
| Water Solubility | Soluble in acetone, chloroform and water (50mg/ml). |
| Solubility | H2O: 50mg/mL |
| Vapor Presure | 0.00702mmHg at 25°C |
| Appearance | liquid |
| Specific Gravity | 1.074 |
| Color | yellow |
| Merck | 14,6712 |
| BRN | 81968 |
| pKa | 9.09±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Stability | Hygroscopic, Light Sensitive, Moisture Sensitive |
| Refractive Index | 1.54 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R39/23/24/25 - R23/24/25 - Toxic by inhalation, in contact with skin and if swallowed. R11 - Highly Flammable |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S16 - Keep away from sources of ignition. S7 - Keep container tightly closed. |
| UN IDs | 2810 |
| WGK Germany | 3 |
| RTECS | QS6350000 |
| FLUKA BRAND F CODES | 3-10 |
| HS Code | 29399990 |
| Hazard Class | 6.1 |
| Packing Group | III |
| Toxicity | LDLo ipr-rat: 6 mg/kg AJEBAK 25,83,47 |
| Use | as standard |