| Name | Beta-Naphthoflavone |
| Synonyms | β-Naphthoflavon 5,6-BENZOFLAVONE 5,6-Benzoflavone β-Naphthoflavone Beta-Naphthoflavone 3-Phenyl-benzo[f]chromen-1-one 3-phenyl-1H-benzo[f]chromen-1-one 3-Phenyl-1H-benzo[f]chromen-1-one 3-Phenyl-1H-naphtho(2,1-b)pyran-1-one 3-Phenyl-1H-naphtho[2,1-b]pyran-1-one 1H-Naphtho[2,1-b]pyran-1-one,3-phenyl- |
| CAS | 6051-87-2 |
| EINECS | 227-958-4 |
| InChI | InChI=1/C19H12O2/c20-16-12-18(14-7-2-1-3-8-14)21-17-11-10-13-6-4-5-9-15(13)19(16)17/h1-12H |
| Molecular Formula | C19H12O2 |
| Molar Mass | 272.3 |
| Density | 1.1382 (rough estimate) |
| Melting Point | 164-166 °C (lit.) |
| Boling Point | 275-280 °C (1 mmHg) |
| Flash Point | 215.8°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Vapor Presure | 1.12E-08mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | yellow to tan |
| BRN | 18991 |
| Storage Condition | 2-8°C |
| Refractive Index | 1.5510 (estimate) |
| MDL | MFCD00004986 |
| Risk Codes | R22 - Harmful if swallowed R34 - Causes burns R11 - Highly Flammable |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S16 - Keep away from sources of ignition. |
| WGK Germany | 3 |
| RTECS | QL6200000 |
| FLUKA BRAND F CODES | 3-10 |
| HS Code | 29329900 |
| Hazard Note | Irritant |
| Reference Show more | 1. Wang Chengyu, Li Dengke, Quan Zhengyang, Hu Ying also, Sun Zhenxiao. Study on hepatotoxicity and related components of Polygonum multiflorum based on cytochrome oxidase CYP2D6 [J]. Pharmacovigilance in China, 2021,18(03):220-227 239. |