| Name | 4-Bromo-N,N-diethylaniline |
| Synonyms | NSC 8071 p-N,Nddiethylaniline N,N-Diethyl-4-bromoaniline 4-Bromo-N,N-diethylaniline N,N-Diethyl-p-bromoaniline p-Bromo-N,N-diethylaniline 4-(Diethylamino)bromobenzene (4-bromophenyl)-diethyl-amine N-(4-Bromophenyl)diethylamine 4-bromo-N,N-diethylbenzenamine N,N-Diethyl-4-bromobenzenamine 1-Bromo-4-(diethylamino)benzene Benzenamine, 4-bromo-N,N-diethyl- Aniline, p-bromo-N,N-diethyl- (8CI) |
| CAS | 2052-06-4 |
| EINECS | 218-140-8 |
| InChI | InChI=1/C10H14BrN/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | NGYMZFJVHHKJQR-UHFFFAOYSA-N |
| Molecular Formula | C10H14BrN |
| Molar Mass | 228.13 |
| Density | 1.291 |
| Melting Point | 32-33 °C (lit.) |
| Boling Point | 269-271°C |
| Flash Point | >230°F |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.00702mmHg at 25°C |
| Appearance | powder to lump |
| Color | White to Light yellow |
| BRN | 2803424 |
| pKa | 5.82±0.32(Predicted) |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Light Sensitive |
| Refractive Index | 1.5870 (estimate) |
| MDL | MFCD00013530 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| TSCA | Yes |
| Hazard Class | 6.1 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |