| Name | 3-Hydroxybenzamide |
| Synonyms | m-Hydroxybenzamide 3-HYDROXYBENZAMIDE 3-Hydroxybenzamide Benzamide,3-hydroxy 3-Hydroxy-benzamide benzamide, 3-hydroxy- BenzaMide, 3-hydroxy- 3-hydroxyphenylformamide Benzamide, 3-hydroxy- (9CI) 3-HYDROXY-BENZOIC ACID,AMIDE 1-phenyl-5-(4-phenylphenyl)-3-pyrazolecarboxylic acid methyl ester |
| CAS | 618-49-5 |
| InChI | InChI=1/C7H7NO2/c8-7(10)5-2-1-3-6(9)4-5/h1-4,9H,(H2,8,10) |
| Molecular Formula | C7H7NO2 |
| Molar Mass | 137.14 |
| Density | 1.449 g/cm3 |
| Melting Point | 170 °C |
| Boling Point | 318.3±25.0 °C(Predicted) |
| Flash Point | 146.3°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.000195mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| pKa | 9.26±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.612 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |